2,3-Dichloro-6-methoxypyridine

Factory supply good quality 2,3-Dichloro-6-methoxypyridine 83732-68-7 with stock We supply high quality 2,3-Dichloro-6-methoxypyridine (CAS 83732-68-7), in stock, factory directly supply to clients, lower prices, more competitiveness.

What is the 2,3-Dichloro-6-methoxypyridine ?

2,3-Dichloro-6-methoxypyridine is , while it's Molecular Formula is C6H5Cl2NO. Used in Pharmaceutical Industry:
2,3-Dichloro-6-methoxypyridine is used as a key intermediate in the synthesis of various pharmaceuticals for its high reactivity and ability to be incorporated into complex drug molecules. Its unique chemical structure allows for the development of new therapeutic agents with potential applications in treating a range of diseases and conditions.
Used in Agrochemical Industry:
2,3-Dichloro-6-methoxypyridine is used as a building block in the production of insecticides and fungicides for its versatility and reactivity. Its incorporation into agricultural chemicals helps in the development of effective pest control solutions, contributing to enhanced crop protection and yield.
Used in Chemical Synthesis:
2,3-Dichloro-6-methoxypyridine is used as a versatile intermediate in various chemical synthesis processes. Its reactivity allows for the formation of a wide range of chemical compounds, making it a valuable component in the development of new materials and products across different industries.

What is the CAS number for 2,3-Dichloro-6-methoxypyridine ?

The CAS number of 2,3-Dichloro-6-methoxypyridine is 83732-68-7.

More information of 2,3-Dichloro-6-methoxypyridine 83732-68-7 are:

What is 2,3-Dichloro-6-methoxypyridine (83732-68-7) used for?

2,3-Dichloro-6-methoxypyridine is a chlorinated derivative of pyridine with the molecular formula C6H5Cl2NO. It features a pyridine ring with two chlorine atoms and one methoxy group attached, contributing to its high reactivity and versatility. This chemical compound serves as a crucial intermediate in the synthesis of pharmaceuticals and agrochemicals, making it a valuable component in the development of new drug molecules and crop protection products.

InChI:InChI=1/C6H5Cl2NO/c1-10-5-3-2-4(7)6(8)9-5/h2-3H,1H3

Articles related to 2,3-Dichloro-6-methoxypyridine:

How to get the best price on 2,3-Dichloro-6-methoxypyridine?

Hebei Nowdo Biological Technology Co., Ltd is a quality supplier and manufacturer of 2,3-Dichloro-6-methoxypyridine . You can buy high quality, low price 2,3-Dichloro-6-methoxypyridine 83732-68-7 here. Contact us.